EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O2S |
| Net Charge | 0 |
| Average Mass | 248.307 |
| Monoisotopic Mass | 248.06195 |
| SMILES | COc1ccc(-c2cc(N)c(C(N)=O)s2)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c1-16-8-4-2-7(3-5-8)10-6-9(13)11(17-10)12(14)15/h2-6H,13H2,1H3,(H2,14,15) |
| InChIKey | OEUITKOCUWEFOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) has role anticonvulsant (CHEBI:35623) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) has role sodium channel modulator (CHEBI:39000) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) is a aromatic amine (CHEBI:33860) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) is a monomethoxybenzene (CHEBI:25235) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) is a primary carboxamide (CHEBI:140324) |
| 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide (CHEBI:233155) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxamide |
| Synonym | Source |
|---|---|
| AA43279 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:354812-16-1 | ChEBI |
| Citations |
|---|