EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO2.HBr |
| Net Charge | 0 |
| Average Mass | 236.109 |
| Monoisotopic Mass | 235.02079 |
| SMILES | Br.COC(=O)C1=CCCN(C)C1 |
| InChI | InChI=1S/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
| InChIKey | AXOJRQLKMVSHHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arecoline hydrobromide (CHEBI:233150) has role carcinogenic agent (CHEBI:50903) |
| arecoline hydrobromide (CHEBI:233150) has role toxin (CHEBI:27026) |
| arecoline hydrobromide (CHEBI:233150) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide |
| Manual Xrefs | Databases |
|---|---|
| HMDB0302632 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:300-08-3 | SUBMITTER |
| Citations |
|---|