EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233148 - AUTEN-99 hydrobromide
| Formula | C17H14N2S.HBr |
| Net Charge | 0 |
| Average Mass | 359.292 |
| Monoisotopic Mass | 358.01393 |
| SMILES | Br.C1=C(c2ccc(-c3ccccc3)cc2)SC2=NCCN12 |
| InChI | InChI=1S/C17H14N2S.BrH/c1-2-4-13(5-3-1)14-6-8-15(9-7-14)16-12-19-11-10-18-17(19)20-16;/h1-9,12H,10-11H2;1H |
| InChIKey | FYYVGPJPIJHFCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AUTEN-99 hydrobromide (CHEBI:233148) has role autophagy inducer (CHEBI:138880) |
| AUTEN-99 hydrobromide (CHEBI:233148) has role geroprotector (CHEBI:176497) |
| AUTEN-99 hydrobromide (CHEBI:233148) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-(4-phenylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide |
| Citations |
|---|