EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233138 - L-α-hydroxyglutaric acid disodium salt
| Formula | C5H6O5.2Na |
| Net Charge | 0 |
| Average Mass | 192.078 |
| Monoisotopic Mass | 192.00106 |
| SMILES | [H][C@](O)(CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | DZHFTEDSQFPDPP-QTNFYWBSSA-L |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-hydroxyglutaric acid disodium salt (CHEBI:233138) has role animal metabolite (CHEBI:75767) |
| L-α-hydroxyglutaric acid disodium salt (CHEBI:233138) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| disodium;(2S)-2-hydroxypentanedioate |
| Synonyms | Source |
|---|---|
| (S)-2-Hydroxybutyric acid | SUBMITTER |
| Sodium (S)-2-hydroxypentanedioate | SUBMITTER |
| Citations |
|---|