EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | Cc1cc2c(C(C)C)c(c1O)O2 |
| InChI | InChI=1S/C10H12O2/c1-5(2)8-7-4-6(3)9(11)10(8)12-7/h4-5,11H,1-3H3 |
| InChIKey | KADNIFXDHADAJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carvacrol ether (CHEBI:233135) has role genotoxin (CHEBI:50902) |
| carvacrol ether (CHEBI:233135) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-methyl-7-propan-2-yl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-trien-2-ol |
| Citations |
|---|