EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | Cc1cccc(C[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2/c1-7-3-2-4-8(5-7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | JZRBSTONIYRNRI-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-L-phenylalanine (CHEBI:233133) is a L-phenylalanine derivative (CHEBI:84144) |
| 3-methyl-L-phenylalanine (CHEBI:233133) is a 3-methylphenylalanine (CHEBI:233953) |
| 3-methyl-L-phenylalanine (CHEBI:233133) is enantiomer of 3-methyl-D-phenylalanine (CHEBI:233954) |
| Incoming Relation(s) |
| 3-methyl-D-phenylalanine (CHEBI:233954) is enantiomer of 3-methyl-L-phenylalanine (CHEBI:233133) |
| IUPAC Name |
|---|
| 3-methyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3-methylphenyl)propanoic acid | IUPAC |
| (S)-2-amino-3-(3-methylphenyl)propanoic acid | ChEBI |
| (S)-2-amino-3-(m-tolyl)propanoic acid | ChEBI |
| L-3-methylphenylalanine | ChEBI |
| Citations |
|---|