EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10INO2 |
| Net Charge | 0 |
| Average Mass | 291.088 |
| Monoisotopic Mass | 290.97563 |
| SMILES | N[C@@H](Cc1cccc(I)c1)C(=O)O |
| InChI | InChI=1S/C9H10INO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | BABTYIKKTLTNRX-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-iodo-L-phenylalanine (CHEBI:233132) has role antineoplastic agent (CHEBI:35610) |
| 3-iodo-L-phenylalanine (CHEBI:233132) is a L-phenylalanine derivative (CHEBI:84144) |
| 3-iodo-L-phenylalanine (CHEBI:233132) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 3-iodo-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3-iodophenyl)propanoic acid | IUPAC |
| (S)-2-amino-3-(3-iodophenyl)propanoic acid | ChEBI |
| m-iodo-L-phenylalanine | ChEBI |
| L-3-iodophenylalanine | ChEBI |
| 3-iodo-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NZ568367 | Patent |
| KR20080074193 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2806893 | Reaxys |
| CAS:20846-39-3 | ChEBI |
| Citations |
|---|