EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11ClFN5 |
| Net Charge | 0 |
| Average Mass | 291.717 |
| Monoisotopic Mass | 291.06870 |
| SMILES | CN(C)/C=N/c1c(C#N)cnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClFN5/c1-19(2)8-17-13-9(6-16)7-18-20(13)10-3-4-12(15)11(14)5-10/h3-5,7-8H,1-2H3/b17-8+ |
| InChIKey | MNCYLHJHZOUDLB-CAOOACKPSA-N |
| Roles Classification |
|---|
| Biological Role: | Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| binucleine 2 (CHEBI:233050) has role Aurora kinase inhibitor (CHEBI:70770) |
| binucleine 2 (CHEBI:233050) is a formamidines (CHEBI:51917) |
| binucleine 2 (CHEBI:233050) is a monochlorobenzenes (CHEBI:83403) |
| binucleine 2 (CHEBI:233050) is a monofluorobenzenes (CHEBI:83575) |
| binucleine 2 (CHEBI:233050) is a nitrile (CHEBI:18379) |
| binucleine 2 (CHEBI:233050) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| N'-[1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide |
| Registry Numbers | Sources |
|---|---|
| CAS:220088-42-6 | SUBMITTER |
| Citations |
|---|