EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO2 |
| Net Charge | 0 |
| Average Mass | 309.409 |
| Monoisotopic Mass | 309.17288 |
| SMILES | COc1ccccc1/C(O)=N/CC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H23NO2/c1-23-18-12-6-5-11-17(18)19(22)21-15-20(13-7-8-14-20)16-9-3-2-4-10-16/h2-6,9-12H,7-8,13-15H2,1H3,(H,21,22) |
| InChIKey | WMHJSKQIZWRPOI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-N-[(1-phenylcyclopentyl)methyl]benzamide (CHEBI:233046) has role potassium channel blocker (CHEBI:50509) |
| 2-methoxy-N-[(1-phenylcyclopentyl)methyl]benzamide (CHEBI:233046) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-methoxy-N-[(1-phenylcyclopentyl)methyl]benzamide |
| Citations |
|---|