EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O.2H3O4P |
| Net Charge | 0 |
| Average Mass | 455.341 |
| Monoisotopic Mass | 455.12225 |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C15H21N3O.2H3O4P/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14;2*1-5(2,3)4/h4,6,8-11,18H,3,5,7,16H2,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | GJOHLWZHWQUKAU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Primaquine Phosphate (CHEBI:232993) has role antimalarial (CHEBI:38068) |
| Primaquine Phosphate (CHEBI:232993) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid | SUBMITTER |
| Malquine | SUBMITTER |
| NSC-149765 | ChEMBL |
| Primaquine bisphosphate | SUBMITTER |
| Primaquini diphosphas | ChEMBL |
| WR 2975 | ChEMBL |
| Brand Name | Source |
|---|---|
| Camden | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:63-45-6 | SUBMITTER |
| Citations |
|---|