EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3 |
| Net Charge | 0 |
| Average Mass | 263.344 |
| Monoisotopic Mass | 263.14225 |
| SMILES | c1ccc2c(c1)CCC[C@H]2Nc1nc2ccccc2n1 |
| InChI | InChI=1S/C17H17N3/c1-2-8-13-12(6-1)7-5-11-14(13)18-17-19-15-9-3-4-10-16(15)20-17/h1-4,6,8-10,14H,5,7,11H2,(H2,18,19,20)/t14-/m1/s1 |
| InChIKey | XZIZUQSOFMLIIR-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NS-8593 (CHEBI:232985) has role TRP channel blocker (CHEBI:139361) |
| NS-8593 (CHEBI:232985) is a benzimidazoles (CHEBI:22715) |
| NS-8593 (CHEBI:232985) is a secondary amino compound (CHEBI:50995) |
| NS-8593 (CHEBI:232985) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1H-benzimidazol-2-amine |
| Synonyms | Source |
|---|---|
| NS 8593 | ChEBI |
| NS8593 | ChEBI |
| (R)-N-(benzimidazol-2-yl)-1,2,3,4-tetrahydro-1-naphthylamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:875755-39-8 | SUBMITTER |
| Citations |
|---|