EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24N2O2S |
| Net Charge | 0 |
| Average Mass | 404.535 |
| Monoisotopic Mass | 404.15585 |
| SMILES | Cc1ccc(OCCn2c(SCCOc3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-19-11-13-21(14-12-19)27-16-15-26-23-10-6-5-9-22(23)25-24(26)29-18-17-28-20-7-3-2-4-8-20/h2-14H,15-18H2,1H3 |
| InChIKey | PNCBJXVNIRRHJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | hormone receptor modulator A drug that modulates the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MEPB (CHEBI:232984) has role hormone receptor modulator (CHEBI:51061) |
| MEPB (CHEBI:232984) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-[2-(4-methylphenoxy)ethyl]-2-(2-phenoxyethylsulfanyl)benzimidazole |