EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N4O4S |
| Net Charge | 0 |
| Average Mass | 282.281 |
| Monoisotopic Mass | 282.04228 |
| SMILES | [H][C@](N)(CSc1nc2ccccn2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H10N4O4S/c11-6(10(15)16)5-19-8-9(14(17)18)13-4-2-1-3-7(13)12-8/h1-4,6H,5,11H2,(H,15,16)/t6-/m0/s1 |
| InChIKey | DSQHYQZBKPIFIF-LURJTMIESA-N |
| Roles Classification |
|---|
| Biological Role: | agonist Substance which binds to cell receptors normally responding to naturally occurring substances and which produces a response of its own. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSC294149 (CHEBI:232978) has role agonist (CHEBI:48705) |
| NSC294149 (CHEBI:232978) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanylpropanoic acid |
| Citations |
|---|