EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232975 - GTS467
| Formula | C22H28N4O3 |
| Net Charge | 0 |
| Average Mass | 396.491 |
| Monoisotopic Mass | 396.21614 |
| SMILES | COc1ccc(/N=C(\O)C(=O)NCC(c2ccccc2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-25-12-14-26(15-13-25)20(17-6-4-3-5-7-17)16-23-21(27)22(28)24-18-8-10-19(29-2)11-9-18/h3-11,20H,12-16H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | HKOVPBBLWISEDY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. |
| Application: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GTS467 (CHEBI:232975) has role glutamate transporter activator (CHEBI:64370) |
| GTS467 (CHEBI:232975) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N'-(4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide |
| Citations |
|---|