EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H7O4S |
| Net Charge | -1 |
| Average Mass | 247.251 |
| Monoisotopic Mass | 247.00705 |
| SMILES | O=C([O-])C(=O)/C=C\c1sc2ccccc2c1O |
| InChI | InChI=1S/C12H8O4S/c13-8(12(15)16)5-6-10-11(14)7-3-1-2-4-9(7)17-10/h1-6,14H,(H,15,16)/p-1/b6-5- |
| InChIKey | CSURGFUIIZATMZ-WAYWQWQTSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoate (CHEBI:23297) is a 4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoate (CHEBI:35904) |
| cis-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoate (CHEBI:23297) is conjugate base of cis-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoic acid (CHEBI:62605) |
| Incoming Relation(s) |
| cis-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoic acid (CHEBI:62605) is conjugate acid of cis-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoate (CHEBI:23297) |
| IUPAC Name |
|---|
| (3Z)-4-(3-hydroxy-1-benzothiophen-2-yl)-2-oxobut-3-enoate |
| Manual Xrefs | Databases |
|---|---|
| c0197 | UM-BBD |