EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16ClN3O2 |
| Net Charge | 0 |
| Average Mass | 365.820 |
| Monoisotopic Mass | 365.09310 |
| SMILES | Nc1ccc(Cl)cc1/C(=N\N=C(/O)c1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O2/c21-14-10-11-17(22)16(12-14)19(13-6-2-1-3-7-13)23-24-20(26)15-8-4-5-9-18(15)25/h1-12,25H,22H2,(H,24,26)/b23-19- |
| InChIKey | XSBRFGZRBIIQTC-NMWGTECJSA-N |
| Roles Classification |
|---|
| Application: | probe A role played by a molecular entity used to study the microscopic environment. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KBH (CHEBI:232964) has role probe (CHEBI:50406) |
| KBH (CHEBI:232964) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(Z)-[(2-amino-5-chlorophenyl)-phenylmethylidene]amino]-2-hydroxybenzamide |
| Citations |
|---|