EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O2S |
| Net Charge | 0 |
| Average Mass | 394.540 |
| Monoisotopic Mass | 394.17150 |
| SMILES | CCc1ccc(-c2nc(CSC/C(O)=N/CCc3ccccc3)c(C)o2)cc1 |
| InChI | InChI=1S/C23H26N2O2S/c1-3-18-9-11-20(12-10-18)23-25-21(17(2)27-23)15-28-16-22(26)24-14-13-19-7-5-4-6-8-19/h4-12H,3,13-16H2,1-2H3,(H,24,26) |
| InChIKey | QTDYVSIBWGVBKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iCRT3 (CHEBI:232963) has role Wnt signalling inhibitor (CHEBI:78031) |
| iCRT3 (CHEBI:232963) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide |
| Synonym | Source |
|---|---|
| iCRT-3 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:901751-47-1 | SUBMITTER |
| Citations |
|---|