EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N4O6 |
| Net Charge | 0 |
| Average Mass | 304.303 |
| Monoisotopic Mass | 304.13828 |
| SMILES | NC(=O)NCCC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N4O6/c12-6(9(17)18)3-4-8(16)15-7(10(19)20)2-1-5-14-11(13)21/h6-7H,1-5,12H2,(H,15,16)(H,17,18)(H,19,20)(H3,13,14,21)/t6-,7-/m0/s1 |
| InChIKey | SCTJBDDLOROJJM-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-glutamylcitrulline (CHEBI:232962) is a N-acyl-amino acid (CHEBI:51569) |