EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N6O8 |
| Net Charge | 0 |
| Average Mass | 384.305 |
| Monoisotopic Mass | 384.10296 |
| SMILES | CCOC(=O)N1CCN(/[N+]([O-])=N/Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16N6O8/c1-2-26-13(20)15-5-7-16(8-6-15)19(25)14-27-12-4-3-10(17(21)22)9-11(12)18(23)24/h3-4,9H,2,5-8H2,1H3/b19-14- |
| InChIKey | DNJRNBYZLPKSHV-RGEXLXHISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JS-K (CHEBI:232953) has role antineoplastic agent (CHEBI:35610) |
| JS-K (CHEBI:232953) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (Z)-(2,4-dinitrophenoxy)imino-(4-ethoxycarbonylpiperazin-1-yl)-oxidoazanium |
| Registry Numbers | Sources |
|---|---|
| CAS:205432-12-8 | SUBMITTER |