EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O3 |
| Net Charge | 0 |
| Average Mass | 365.433 |
| Monoisotopic Mass | 365.17394 |
| SMILES | Cc1ccc2c(C(=O)CN3CCN(C(=O)c4ccco4)CC3)c(C)nc2c1 |
| InChI | InChI=1S/C21H23N3O3/c1-14-5-6-16-17(12-14)22-15(2)20(16)18(25)13-23-7-9-24(10-8-23)21(26)19-4-3-11-27-19/h3-6,11-12,22H,7-10,13H2,1-2H3 |
| InChIKey | VMGUWRHRHRBXFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of any phosphotransferase with an alcohol group as acceptor (EC 2.7.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMB639752 (CHEBI:232952) has role EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor (CHEBI:76881) |
| AMB639752 (CHEBI:232952) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-(2,6-dimethyl-1H-indol-3-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
| Registry Numbers | Sources |
|---|---|
| CAS:371210-26-3 | SUBMITTER |
| Citations |
|---|