EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12ClNO4 |
| Net Charge | 0 |
| Average Mass | 269.684 |
| Monoisotopic Mass | 269.04549 |
| SMILES | Cc1cc2c(c(C)c1Cl)N(CC(=O)O)C(=O)CO2 |
| InChI | InChI=1S/C12H12ClNO4/c1-6-3-8-12(7(2)11(6)13)14(4-10(16)17)9(15)5-18-8/h3H,4-5H2,1-2H3,(H,16,17) |
| InChIKey | SUZXIGFIHWADFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor An EC 1.14.* (oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the action of any such enzyme incorporating one atom of oxygen and using NADH or NADPH as one donor (EC 1.14.13.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(6-chloro-5,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid (CHEBI:232950) has role EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor (CHEBI:76841) |
| 2-(6-chloro-5,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid (CHEBI:232950) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-(6-chloro-5,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid |
| Citations |
|---|