EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232949 - iCRT5
| Formula | C16H17NO5S2 |
| Net Charge | 0 |
| Average Mass | 367.448 |
| Monoisotopic Mass | 367.05481 |
| SMILES | [H]/C(=C1/SC(=S)N(CCCC(=O)O)C1=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H17NO5S2/c1-21-11-6-5-10(8-12(11)22-2)9-13-15(20)17(16(23)24-13)7-3-4-14(18)19/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19)/b13-9- |
| InChIKey | IJWKSBPTJQMUHJ-LCYFTJDESA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iCRT5 (CHEBI:232949) has role Wnt signalling inhibitor (CHEBI:78031) |
| iCRT5 (CHEBI:232949) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| Citations |
|---|