EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N5O2 |
| Net Charge | 0 |
| Average Mass | 363.421 |
| Monoisotopic Mass | 363.16952 |
| SMILES | Cn1cnnc1C1CCN(c2ncccc2-c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H21N5O2/c1-24-12-22-23-19(24)14-6-9-25(10-7-14)20-16(3-2-8-21-20)15-4-5-17-18(11-15)27-13-26-17/h2-5,8,11-12,14H,6-7,9-10,13H2,1H3 |
| InChIKey | VTNPBFLOKBXXLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.3.2.* (aminoacyltransferase) inhibitor An EC 2.3.* (acyltransferase) inhibitor that interferes with the action of any aminoacyltransferase (EC 2.3.2.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SEN180 (CHEBI:232946) has role EC 2.3.2.* (aminoacyltransferase) inhibitor (CHEBI:76877) |
| SEN180 (CHEBI:232946) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-(1,3-benzodioxol-5-yl)-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridine |
| Citations |
|---|