EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CC(C)(C)C[C@@]1([H])[C@]1(C)C(=C)CC[C@]1([H])C2 |
| InChI | InChI=1S/C15H24/c1-10-5-6-12-7-11-8-14(2,3)9-13(11)15(10,12)4/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m0/s1 |
| InChIKey | XEORYLRYWDQOAT-KYEXWDHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum hirsutum (ncbitaxon:40492) | - | PubMed (29625976) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hirsutene (CHEBI:232913) has role fungal metabolite (CHEBI:76946) |
| Hirsutene (CHEBI:232913) is a sesquiterpene (CHEBI:35189) |
| Hirsutene (CHEBI:232913) is a tricyclic hydrocarbon (CHEBI:51119) |
| Citations |
|---|