EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232896 - SB-269970 hydrochloride
| Formula | C18H28N2O3S.HCl |
| Net Charge | 0 |
| Average Mass | 388.961 |
| Monoisotopic Mass | 388.15874 |
| SMILES | Cl.[H][C@]1(CCN2CCC(C)CC2)CCCN1S(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C18H28N2O3S.ClH/c1-15-7-11-19(12-8-15)13-9-16-4-3-10-20(16)24(22,23)18-6-2-5-17(21)14-18;/h2,5-6,14-16,21H,3-4,7-13H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | XQCJOYZLWFNDIO-PKLMIRHRSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB-269970 hydrochloride (CHEBI:232896) has role serotonergic antagonist (CHEBI:48279) |
| SB-269970 hydrochloride (CHEBI:232896) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-[(2R)-2-[2-(4-methylpiperidin-1-yl)ethyl]pyrrolidin-1-yl]sulfonylphenol;hydrochloride |
| Registry Numbers | Sources |
|---|---|
| CAS:261901-57-9 | SUBMITTER |
| Citations |
|---|