EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O3 |
| Net Charge | 0 |
| Average Mass | 355.398 |
| Monoisotopic Mass | 355.16444 |
| SMILES | CC(C)c1ccc(NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H21N5O3/c1-11(2)12-5-7-13(8-6-12)20-14(24)9-23-10-19-16-15(23)17(25)22(4)18(26)21(16)3/h5-8,10-11H,9H2,1-4H3,(H,20,24) |
| InChIKey | HEQDZPHDVAOBLN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | TRP channel modulator An agent that modulates the passage of cations through the transient receptor potential (TRP) channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HC-030031 (CHEBI:232895) has role TRP channel modulator (CHEBI:142783) |
| HC-030031 (CHEBI:232895) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-propan-2-ylphenyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| HMDB0253057 | HMDB |
| https://en.wikipedia.org/wiki/HC-030031 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:349085-38-7 | SUBMITTER |