EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O3 |
| Net Charge | 0 |
| Average Mass | 362.429 |
| Monoisotopic Mass | 362.16304 |
| SMILES | CC1CC(C)(C)N(C(=O)CN2C(=O)c3ccccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H22N2O3/c1-14-12-22(2,3)24(18-11-7-6-8-15(14)18)19(25)13-23-20(26)16-9-4-5-10-17(16)21(23)27/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | KDDHBJICVBONAX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | TRP channel modulator An agent that modulates the passage of cations through the transient receptor potential (TRP) channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML-SA1 (CHEBI:232894) has role TRP channel modulator (CHEBI:142783) |
| ML-SA1 (CHEBI:232894) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[2-oxo-2-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethyl]isoindole-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/ML-SA1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:332382-54-4 | SUBMITTER |