EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232879 - iCRT14
| Formula | C21H17N3O2S |
| Net Charge | 0 |
| Average Mass | 375.453 |
| Monoisotopic Mass | 375.10415 |
| SMILES | [H]/C(=C1/SC(=O)N(c2ccccc2)C1=O)c1cc(C)n(-c2cccnc2)c1C |
| InChI | InChI=1S/C21H17N3O2S/c1-14-11-16(15(2)23(14)18-9-6-10-22-13-18)12-19-20(25)24(21(26)27-19)17-7-4-3-5-8-17/h3-13H,1-2H3/b19-12- |
| InChIKey | NCSHZXNGQYSKLR-UNOMPAQXSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iCRT14 (CHEBI:232879) has role Wnt signalling inhibitor (CHEBI:78031) |
| iCRT14 (CHEBI:232879) is a thiazolidinediones (CHEBI:50990) |
| IUPAC Name |
|---|
| (5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| Registry Numbers | Sources |
|---|---|
| CAS:677331-12-3 | SUBMITTER |
| Citations |
|---|