EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O2S |
| Net Charge | 0 |
| Average Mass | 395.528 |
| Monoisotopic Mass | 395.16675 |
| SMILES | O=C(c1cc2c(s1)CCCCC2)N1CCC(n2c(O)nc3ccccc32)CC1 |
| InChI | InChI=1S/C22H25N3O2S/c26-21(20-14-15-6-2-1-3-9-19(15)28-20)24-12-10-16(11-13-24)25-18-8-5-4-7-17(18)23-22(25)27/h4-5,7-8,14,16H,1-3,6,9-13H2,(H,23,27) |
| InChIKey | AXWRAIIIBRLXBP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | TRP channel modulator An agent that modulates the passage of cations through the transient receptor potential (TRP) channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK1702934A (CHEBI:232878) has role TRP channel modulator (CHEBI:142783) |
| GSK1702934A (CHEBI:232878) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-[1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/GSK1702934A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:924377-85-5 | SUBMITTER |
| Citations |
|---|