EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26ClN5O2 |
| Net Charge | 0 |
| Average Mass | 439.947 |
| Monoisotopic Mass | 439.17750 |
| SMILES | [H][C@@]1(Cn2/c(=N/Cc3ccccc3Cl)nc3cc(C(=N)O)cc(N)c32)CCCC=C[C@]1([H])O |
| InChI | InChI=1S/C23H26ClN5O2/c24-17-8-5-4-6-14(17)12-27-23-28-19-11-16(22(26)31)10-18(25)21(19)29(23)13-15-7-2-1-3-9-20(15)30/h3-6,8-11,15,20,30H,1-2,7,12-13,25H2,(H2,26,31)(H,27,28)/t15-,20-/m0/s1 |
| InChIKey | LZIRGQWHRATVHY-YWZLYKJASA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.* (carboxylic ester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a carboxylic ester hydrolase (EC 3.1.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JZL184 (CHEBI:232864) has role EC 3.1.1.* (carboxylic ester hydrolase) inhibitor (CHEBI:76773) |
| JZL184 (CHEBI:232864) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 7-amino-2-[(2-chlorophenyl)methylamino]-1-[[(1S,2S)-2-hydroxycyclohept-3-en-1-yl]methyl]benzimidazole-5-carboxamide |
| Citations |
|---|