EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232863 - GT-951
| Formula | C31H30F3N7O2 |
| Net Charge | 0 |
| Average Mass | 589.622 |
| Monoisotopic Mass | 589.24131 |
| SMILES | COc1ccc2nc(=O)c(C(c3nnnn3CCc3ccccc3)N3CCN(c4cccc(C(F)(F)F)c4)CC3)cc2c1 |
| InChI | InChI=1S/C31H30F3N7O2/c1-43-25-10-11-27-22(18-25)19-26(30(42)35-27)28(29-36-37-38-41(29)13-12-21-6-3-2-4-7-21)40-16-14-39(15-17-40)24-9-5-8-23(20-24)31(32,33)34/h2-11,18-20,28H,12-17H2,1H3,(H,35,42) |
| InChIKey | FAUBXPJKRZBEGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. |
| Application: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GT-951 (CHEBI:232863) has role glutamate transporter activator (CHEBI:64370) |
| GT-951 (CHEBI:232863) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 6-methoxy-3-[[1-(2-phenylethyl)tetrazol-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1H-quinolin-2-one |
| Citations |
|---|