EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47FN6O4S |
| Net Charge | 0 |
| Average Mass | 630.831 |
| Monoisotopic Mass | 630.33635 |
| SMILES | CC(C)N(C(=O)c1cc(F)ccc1Oc1cncnc1N1CC2(CCN(CC3CCC(NS(C)(=O)=O)CC3)CC2)C1)C(C)C |
| InChI | InChI=1S/C32H47FN6O4S/c1-22(2)39(23(3)4)31(40)27-16-25(33)8-11-28(27)43-29-17-34-21-35-30(29)38-19-32(20-38)12-14-37(15-13-32)18-24-6-9-26(10-7-24)36-44(5,41)42/h8,11,16-17,21-24,26,36H,6-7,9-10,12-15,18-20H2,1-5H3 |
| InChIKey | ADHHOUXZPBYYSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| VTP-50469 (CHEBI:232861) has role antineoplastic agent (CHEBI:35610) |
| VTP-50469 (CHEBI:232861) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 5-fluoro-2-[4-[7-[[4-(methanesulfonamido)cyclohexyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]pyrimidin-5-yl]oxy-N,N-di(propan-2-yl)benzamide |
| Citations |
|---|