EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H47N5O8 |
| Net Charge | 0 |
| Average Mass | 641.766 |
| Monoisotopic Mass | 641.34246 |
| SMILES | [H][C@@]1(c2cc(OC)c(O)c(OC)c2)c2cc3c(cc2[C@@]([H])(/N=C(\O)CNCCCNCCCCNCCCN)[C@@]2([H])COC(=O)[C@]12[H])OCO3 |
| InChI | InChI=1S/C33H47N5O8/c1-42-26-13-20(14-27(43-2)32(26)40)29-21-15-24-25(46-19-45-24)16-22(21)31(23-18-44-33(41)30(23)29)38-28(39)17-37-12-6-11-36-9-4-3-8-35-10-5-7-34/h13-16,23,29-31,35-37,40H,3-12,17-19,34H2,1-2H3,(H,38,39)/t23-,29+,30-,31+/m0/s1 |
| InChIKey | NUZMJDHDPVKFJN-TYDXHICZSA-N |
| Roles Classification |
|---|
| Biological Role: | topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F-14512 (CHEBI:232860) has role antineoplastic agent (CHEBI:35610) |
| F-14512 (CHEBI:232860) has role topoisomerase II inhibitor (CHEBI:156203) |
| F-14512 (CHEBI:232860) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-2-[3-[4-(3-aminopropylamino)butylamino]propylamino]acetamide |
| Registry Numbers | Sources |
|---|---|
| CAS:866874-63-7 | SUBMITTER |
| Citations |
|---|