EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N4O2.2HCl |
| Net Charge | 0 |
| Average Mass | 351.278 |
| Monoisotopic Mass | 350.12763 |
| SMILES | Cl.Cl.N=C(NOCC(O)CN1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C14H22N4O2.2ClH/c15-14(12-5-4-6-16-9-12)17-20-11-13(19)10-18-7-2-1-3-8-18;;/h4-6,9,13,19H,1-3,7-8,10-11H2,(H2,15,17);2*1H |
| InChIKey | ISGGVCWFTPTHIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BGP-15 (CHEBI:232856) has role cardioprotective agent (CHEBI:77307) |
| BGP-15 (CHEBI:232856) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N'-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidamide;dihydrochloride |
| Registry Numbers | Sources |
|---|---|
| CAS:66611-37-8 | SUBMITTER |
| Citations |
|---|