EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24N6O2S4 |
| Net Charge | 0 |
| Average Mass | 628.830 |
| Monoisotopic Mass | 628.08436 |
| SMILES | O/C(=N\CCc1nccs1)c1cnc2c(SSc3cccc4cc(/C(O)=N/CCc5nccs5)cnc34)cccc2c1 |
| InChI | InChI=1S/C30H24N6O2S4/c37-29(33-9-7-25-31-11-13-39-25)21-15-19-3-1-5-23(27(19)35-17-21)41-42-24-6-2-4-20-16-22(18-36-28(20)24)30(38)34-10-8-26-32-12-14-40-26/h1-6,11-18H,7-10H2,(H,33,37)(H,34,38) |
| InChIKey | RNEOHKZPZKEZCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capzimin dimer (CHEBI:232854) has role proteasome inhibitor (CHEBI:52726) |
| capzimin dimer (CHEBI:232854) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[2-(1,3-thiazol-2-yl)ethyl]-8-[[3-[2-(1,3-thiazol-2-yl)ethylcarbamoyl]quinolin-8-yl]disulfanyl]quinoline-3-carboxamide |
| Citations |
|---|