EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15ClN4O3 |
| Net Charge | 0 |
| Average Mass | 322.752 |
| Monoisotopic Mass | 322.08327 |
| SMILES | [H][C@]12CC[C@]([H])(O1)N1CCN(Cc3ccc(Cl)nc3)C1=C2[N+](=O)[O-] |
| InChI | InChI=1S/C14H15ClN4O3/c15-11-3-1-9(7-16-11)8-17-5-6-18-12-4-2-10(22-12)13(14(17)18)19(20)21/h1,3,7,10,12H,2,4-6,8H2/t10-,12+/m1/s1 |
| InChIKey | NDHXMRFNYMNBKO-PWSUYJOCSA-N |
| Roles Classification |
|---|
| Biological Role: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloxaprid (CHEBI:232852) has role neonicotinoid insectide (CHEBI:25540) |
| cycloxaprid (CHEBI:232852) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (1S,8R)-5-[(6-chloropyridin-3-yl)methyl]-7-nitro-11-oxa-2,5-diazatricyclo[6.2.1.02,6]undec-6-ene |
| Citations |
|---|