EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N3O4 |
| Net Charge | 0 |
| Average Mass | 459.546 |
| Monoisotopic Mass | 459.21581 |
| SMILES | O/C(CN1CCC(O)CC1)=N\c1ccc(Oc2ccc3c(c2)CCC(c2ccccc2)O3)nc1 |
| InChI | InChI=1S/C27H29N3O4/c31-22-12-14-30(15-13-22)18-26(32)29-21-7-11-27(28-17-21)33-23-8-10-25-20(16-23)6-9-24(34-25)19-4-2-1-3-5-19/h1-5,7-8,10-11,16-17,22,24,31H,6,9,12-15,18H2,(H,29,32) |
| InChIKey | UPGUBLDTYLMRHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ORM-10962 (CHEBI:232848) has role ion transport inhibitor (CHEBI:50184) |
| ORM-10962 (CHEBI:232848) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|