EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39N3O3 |
| Net Charge | 0 |
| Average Mass | 501.671 |
| Monoisotopic Mass | 501.29914 |
| SMILES | [H][C@@]1(N(CCC)CCN2CCN(c3ccc(-c4ccc(O)c(O)c4)cc3)CC2)CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C31H39N3O3/c1-2-14-33(27-11-12-28-25(21-27)4-3-5-29(28)35)18-15-32-16-19-34(20-17-32)26-9-6-23(7-10-26)24-8-13-30(36)31(37)22-24/h3-10,13,22,27,35-37H,2,11-12,14-21H2,1H3/t27-/m1/s1 |
| InChIKey | WVYXHYCDEPEXKY-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Application: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-520 (CHEBI:232847) has role dopamine agonist (CHEBI:51065) |
| D-520 (CHEBI:232847) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4-[4-[4-[2-[[(2R)-5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]ethyl]piperazin-1-yl]phenyl]benzene-1,2-diol |
| Citations |
|---|