EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H12ClF5N2 |
| Net Charge | 0 |
| Average Mass | 422.784 |
| Monoisotopic Mass | 422.06092 |
| SMILES | Fc1ccc(-c2c3cccc(C(F)(F)F)c3nn2Cc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C21H12ClF5N2/c22-18-10-15(24)9-6-13(18)11-29-20(12-4-7-14(23)8-5-12)16-2-1-3-17(19(16)28-29)21(25,26)27/h1-10H,11H2 |
| InChIKey | KYWWJENKIMRJBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | liver X receptor agonist Any compound that acts as an agonist towards the liver X receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LX-623 (CHEBI:232814) has role liver X receptor agonist (CHEBI:86029) |
| LX-623 (CHEBI:232814) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[(2-chloro-4-fluorophenyl)methyl]-3-(4-fluorophenyl)-7-(trifluoromethyl)indazole |
| Synonyms | Source |
|---|---|
| Lx-623 | ChEMBL |
| Lx623 | ChEMBL |
| lxr-623 | ChEMBL |
| Lxr-623 | ChEMBL |
| Way252623 | ChEMBL |
| WAY-252623 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| HMDB0247547 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:875787-07-8 | SUBMITTER |
| Citations |
|---|