EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28N4O3S2 |
| Net Charge | 0 |
| Average Mass | 520.680 |
| Monoisotopic Mass | 520.16028 |
| SMILES | Cc1cc(OCc2nnc(SC3CCCC3)n2-c2cccnc2)ccc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H28N4O3S2/c1-19-16-22(11-14-25(19)20-9-12-24(13-10-20)36(2,32)33)34-18-26-29-30-27(35-23-7-3-4-8-23)31(26)21-6-5-15-28-17-21/h5-6,9-17,23H,3-4,7-8,18H2,1-2H3 |
| InChIKey | UJGTUKMAJVCBIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.4.* (hydrolases acting on ATP; involved in cellular and subcellular movement) inhibitor An EC 3.6.* (hydrolases acting on acid anhydrides) inhibitor that interferes with the action of any such enzyme acting on ATP and involved in cellular and subcellular movement (EC 3.6.4.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NMS-873 (CHEBI:232809) has role EC 3.6.4.* (hydrolases acting on ATP; involved in cellular and subcellular movement) inhibitor (CHEBI:76938) |
| NMS-873 (CHEBI:232809) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-[3-cyclopentylsulfanyl-5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1,2,4-triazol-4-yl]pyridine |
| Registry Numbers | Sources |
|---|---|
| CAS:1418013-75-8 | SUBMITTER |
| Citations |
|---|