EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | [H][C@@](C)(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1 |
| InChIKey | NGSFWBMYFKHRBD-DKWTVANSSA-M |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. |
| Application: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial agent (CHEBI:33281) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial food preservative (CHEBI:65256) |
| sodium L-lactate (CHEBI:232798) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| sodium;(2S)-2-hydroxypropanoate |
| Registry Numbers | Sources |
|---|---|
| CAS:867-56-1 | SUBMITTER |
| Citations |
|---|