EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232798 - sodium L-lactate
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | [H][C@@](C)(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1 |
| InChIKey | NGSFWBMYFKHRBD-DKWTVANSSA-M |
| Roles Classification |
|---|
| Chemical Role: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Biological Roles: | antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial agent (CHEBI:33281) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| sodium L-lactate (CHEBI:232798) has role antimicrobial food preservative (CHEBI:65256) |
| sodium L-lactate (CHEBI:232798) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| sodium;(2S)-2-hydroxypropanoate |
| Registry Numbers | Sources |
|---|---|
| CAS:867-56-1 | SUBMITTER |
| Citations |
|---|