EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C2H3O2.Cd |
| Net Charge | 0 |
| Average Mass | 230.500 |
| Monoisotopic Mass | 231.92997 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C2H4O2.Cd/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | LHQLJMJLROMYRN-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadmium acetate (CHEBI:232796) has role carcinogenic agent (CHEBI:50903) |
| cadmium acetate (CHEBI:232796) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| cadmium(2+);diacetate |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/Cadmium_acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:543-90-8 | SUBMITTER |
| Citations |
|---|