EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232795 - 3BDO
| Formula | C18H17NO5 |
| Net Charge | 0 |
| Average Mass | 327.336 |
| Monoisotopic Mass | 327.11067 |
| SMILES | O=C1OC(COc2ccccc2[N+](=O)[O-])CC1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO5/c20-18-14(10-13-6-2-1-3-7-13)11-15(24-18)12-23-17-9-5-4-8-16(17)19(21)22/h1-9,14-15H,10-12H2 |
| InChIKey | AXPZIVKEZRHGAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3BDO (CHEBI:232795) has role autophagy inhibitor (CHEBI:88230) |
| 3BDO (CHEBI:232795) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-benzyl-5-[(2-nitrophenoxy)methyl]oxolan-2-one |
| Citations |
|---|