EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H31ClF3NO3.HCl |
| Net Charge | 0 |
| Average Mass | 618.523 |
| Monoisotopic Mass | 617.17113 |
| SMILES | Cl.O=C(O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H31ClF3NO3.ClH/c34-32-27(15-8-17-30(32)33(35,36)37)22-38(18-9-19-41-28-16-7-10-24(20-28)21-31(39)40)23-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26;/h1-8,10-17,20,29H,9,18-19,21-23H2,(H,39,40);1H |
| InChIKey | NMPUWJFHNOUNQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | liver X receptor agonist Any compound that acts as an agonist towards the liver X receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW3965 hydrochloride (CHEBI:232793) has role liver X receptor agonist (CHEBI:86029) |
| GW3965 hydrochloride (CHEBI:232793) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetic acid;hydrochloride |
| Registry Numbers | Sources |
|---|---|
| CAS:405911-17-3 | SUBMITTER |
| Citations |
|---|