EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N4O2 |
| Net Charge | 0 |
| Average Mass | 360.417 |
| Monoisotopic Mass | 360.15863 |
| SMILES | CN(C)CC/N=C(\O)c1cccn2c(=O)c3cc4ccccc4cc3nc12 |
| InChI | InChI=1S/C21H20N4O2/c1-24(2)11-9-22-20(26)16-8-5-10-25-19(16)23-18-13-15-7-4-3-6-14(15)12-17(18)21(25)27/h3-8,10,12-13H,9,11H2,1-2H3,(H,22,26) |
| InChIKey | BXYDVWIAGDJBEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMH-21 (CHEBI:232779) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| BMH-21 (CHEBI:232779) has role intercalator (CHEBI:24853) |
| BMH-21 (CHEBI:232779) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[2-(dimethylamino)ethyl]-12-oxo-12H-benzo[g]pyrido[2,1-b]quinazoline-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| CAS:896705-16-1 | SUBMITTER |
| Citations |
|---|