EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)C[C@H](O)[C@@]3([H])[C@]1([H])CCC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C19H26O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)16(22)10-15(21)17(13)19/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14+,15+,17-,18+,19-/m1/s1 |
| InChIKey | MYKMKUGZFQKMOZ-CKDIOHLVSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) has role fungal metabolite (CHEBI:76946) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) has role human metabolite (CHEBI:77746) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) is a 15α-hydroxy steroid (CHEBI:83147) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) is a 17-oxo steroid (CHEBI:19168) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 15α-hydroxyandrost-4-ene-3,17-dione |
| Synonyms | Source |
|---|---|
| (15α)-15-hydroxyandrost-4-ene-3,17-dione | ChEBI |
| 15α-hydroxy-4-androstene-3,17-dione | ChEBI |
| 15α-hydroxyandrostenedione | ChEBI |
| UniProt Name | Source |
|---|---|
| 15α-hydroxy-androst-4-ene-3,17-dione | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:566-08-5 | ChEBI |
| Citations |
|---|