EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2 |
| Net Charge | 0 |
| Average Mass | 216.328 |
| Monoisotopic Mass | 216.16265 |
| SMILES | [H][C@@]1(NC2CCNCC2)C[C@@]1([H])c1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-2-4-11(5-3-1)13-10-14(13)16-12-6-8-15-9-7-12/h1-5,12-16H,6-10H2/t13-,14+/m0/s1 |
| InChIKey | BASFYRLYJAZPPL-UONOGXRCSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor An EC 1.14.* (oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the function of any such enzyme using 2-oxoglutarate as one donor and incorporating one atom each of oxygen into both donors (EC 1.14.11.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK-LSD1 (CHEBI:232752) has role EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor (CHEBI:76902) |
| GSK-LSD1 (CHEBI:232752) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine |
| Citations |
|---|