EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38N8O2 |
| Net Charge | 0 |
| Average Mass | 542.688 |
| Monoisotopic Mass | 542.31177 |
| SMILES | Cc1cc2cc(n1)-c1cnn(C)c1OCCC[C@@H](C)CN1/C(=N/C2=O)Nc2ccc(CN3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C30H38N8O2/c1-20-6-5-13-40-29-24(17-31-36(29)4)26-16-23(14-21(2)32-26)28(39)34-30-33-25-8-7-22(15-27(25)38(30)18-20)19-37-11-9-35(3)10-12-37/h7-8,14-17,20H,5-6,9-13,18-19H2,1-4H3,(H,33,34,39)/t20-/m1/s1 |
| InChIKey | AIQBYZOTCIQTGW-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BI-4020 (CHEBI:232716) has role antineoplastic agent (CHEBI:35610) |
| BI-4020 (CHEBI:232716) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| BI-4020 (CHEBI:232716) is a N-methylpiperazine (CHEBI:46920) |
| BI-4020 (CHEBI:232716) is a ether (CHEBI:25698) |
| BI-4020 (CHEBI:232716) is a indoles (CHEBI:24828) |
| BI-4020 (CHEBI:232716) is a macrocycle (CHEBI:51026) |
| BI-4020 (CHEBI:232716) is a pyrazoles (CHEBI:26410) |
| BI-4020 (CHEBI:232716) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| [10(10a)E,18R]-1,6,18-trimethyl-14-[(4-methylpiperazin-1-yl)methyl]-18,19,20,21-tetrahydro-1H,17H-8,4-(metheno)pyrazolo[3',4':2,3][1,5,10,12]oxatriazacycloheptadecino[12,11-a]benzimidazol-9(11H)-one |
| Synonyms | Source |
|---|---|
| BI 4020 | ChEBI |
| BI4020 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| XA4 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:2664214-60-0 | ChEBI |
| Citations |
|---|