EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28ClN3OS.HCl |
| Net Charge | 0 |
| Average Mass | 526.533 |
| Monoisotopic Mass | 525.14084 |
| SMILES | CNC1CCC(N(Cc2cccc(-c3ccncc3)c2)C(=O)c2sc3ccccc3c2Cl)CC1.Cl |
| InChI | InChI=1S/C28H28ClN3OS.ClH/c1-30-22-9-11-23(12-10-22)32(28(33)27-26(29)24-7-2-3-8-25(24)34-27)18-19-5-4-6-21(17-19)20-13-15-31-16-14-20;/h2-8,13-17,22-23,30H,9-12,18H2,1H3;1H |
| InChIKey | CRWTYWYPPITOOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | G-protein-coupled receptor agonist An agonist that binds to and activates G-protein-coupled receptors |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SAG hydrochloride (CHEBI:232702) has role G-protein-coupled receptor agonist (CHEBI:70998) |
| SAG hydrochloride (CHEBI:232702) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Smoothened agonist hydrochloride | SUBMITTER |