EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C10H14N2.H2O4S |
| Net Charge | 0 |
| Average Mass | 422.551 |
| Monoisotopic Mass | 422.19878 |
| SMILES | O=S(=O)(O)O.[H][C@@]1(c2cccnc2)CCCN1C.[H][C@@]1(c2cccnc2)CCCN1C |
| InChI | InChI=1S/2C10H14N2.H2O4S/c2*1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-5(2,3)4/h2*2,4,6,8,10H,3,5,7H2,1H3;(H2,1,2,3,4)/t2*10-;/m00./s1 |
| InChIKey | IECQULMJVNSKDB-RCWTXCDDSA-N |
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotine sulfate (CHEBI:232650) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| nicotine sulfate (CHEBI:232650) has role teratogenic agent (CHEBI:50905) |
| nicotine sulfate (CHEBI:232650) is a organic molecular entity (CHEBI:50860) |
| Registry Numbers | Sources |
|---|---|
| CAS:65-30-5 | SUBMITTER |