EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C10H14N2.H2O4S |
| Net Charge | 0 |
| Average Mass | 422.551 |
| Monoisotopic Mass | 422.19878 |
| SMILES | O=S(=O)(O)O.[H][C@@]1(c2cccnc2)CCCN1C.[H][C@@]1(c2cccnc2)CCCN1C |
| InChI | InChI=1S/2C10H14N2.H2O4S/c2*1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-5(2,3)4/h2*2,4,6,8,10H,3,5,7H2,1H3;(H2,1,2,3,4)/t2*10-;/m00./s1 |
| InChIKey | IECQULMJVNSKDB-RCWTXCDDSA-N |
| Roles Classification |
|---|
| Biological Roles: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotine sulfate (CHEBI:232650) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| nicotine sulfate (CHEBI:232650) has role teratogenic agent (CHEBI:50905) |
| nicotine sulfate (CHEBI:232650) is a organic molecular entity (CHEBI:50860) |
| Registry Numbers | Sources |
|---|---|
| CAS:65-30-5 | SUBMITTER |